Carboxylic acids and derivatives
Filtered Search Results
Ethyl decanoate, 99%
CAS: 110-38-3 Molecular Formula: C12H24O2 Molecular Weight (g/mol): 200.322 MDL Number: MFCD00009581 InChI Key: RGXWDWUGBIJHDO-UHFFFAOYSA-N Synonym: ethyl caprate,ethyl caprinate,ethyl decylate,decanoic acid ethyl ester,decanoic acid, ethyl ester,capric acid ethyl ester,ethyl n-decanoate,capric acid, ethyl ester,natural,unii-gy39fb86uo PubChem CID: 8048 ChEBI: CHEBI:87430 IUPAC Name: ethyl decanoate SMILES: CCCCCCCCCC(=O)OCC
| PubChem CID | 8048 |
|---|---|
| CAS | 110-38-3 |
| Molecular Weight (g/mol) | 200.322 |
| ChEBI | CHEBI:87430 |
| MDL Number | MFCD00009581 |
| SMILES | CCCCCCCCCC(=O)OCC |
| Synonym | ethyl caprate,ethyl caprinate,ethyl decylate,decanoic acid ethyl ester,decanoic acid, ethyl ester,capric acid ethyl ester,ethyl n-decanoate,capric acid, ethyl ester,natural,unii-gy39fb86uo |
| IUPAC Name | ethyl decanoate |
| InChI Key | RGXWDWUGBIJHDO-UHFFFAOYSA-N |
| Molecular Formula | C12H24O2 |
2,2-Dimethylbutyric acid, 97%
CAS: 595-37-9 Molecular Formula: C6H12O2 Molecular Weight (g/mol): 116.16 MDL Number: MFCD00004200 InChI Key: VUAXHMVRKOTJKP-UHFFFAOYSA-N Synonym: 2,2-dimethylbutyric acid,butanoic acid, 2,2-dimethyl,2,2-dimethyl-butanoic acid,2,2-dimethyl butyric acid,2,2-dimethyl butanoic acid,unii-ay606cn05o,butyric acid, 2,2-dimethyl,dimethyl ethyl acetic acid,2,2-dimethyl-butyric acid,.alpha.,.alpha.-dimethylbutyric acid PubChem CID: 11684 ChEBI: CHEBI:38649 IUPAC Name: 2,2-dimethylbutanoic acid SMILES: CCC(C)(C)C(=O)O
| PubChem CID | 11684 |
|---|---|
| CAS | 595-37-9 |
| Molecular Weight (g/mol) | 116.16 |
| ChEBI | CHEBI:38649 |
| MDL Number | MFCD00004200 |
| SMILES | CCC(C)(C)C(=O)O |
| Synonym | 2,2-dimethylbutyric acid,butanoic acid, 2,2-dimethyl,2,2-dimethyl-butanoic acid,2,2-dimethyl butyric acid,2,2-dimethyl butanoic acid,unii-ay606cn05o,butyric acid, 2,2-dimethyl,dimethyl ethyl acetic acid,2,2-dimethyl-butyric acid,.alpha.,.alpha.-dimethylbutyric acid |
| IUPAC Name | 2,2-dimethylbutanoic acid |
| InChI Key | VUAXHMVRKOTJKP-UHFFFAOYSA-N |
| Molecular Formula | C6H12O2 |
3-(tert-Butyl)-1-methyl-1H-pyrazole-carboxylic acid, 95%
CAS: 175277-11-9 Molecular Formula: C9H14N2O2 Molecular Weight (g/mol): 182.22 InChI Key: SFSXXMXHJOSBAZ-UHFFFAOYSA-N Synonym: 3-tert-butyl-1-methyl-1h-pyrazole-5-carboxylic acid,3-tert-butyl-1-methylpyrazole-5-carboxylic acid,5-tert-butyl-2-methyl-2h-pyrazole-3-carboxylic acid,1h-pyrazole-5-carboxylic acid, 3-1,1-dimethylethyl-1-methyl,3-t-butyl-1-methyl-1h-pyrazole-5-carboxylic acid,maybridge1_008671,acmc-1bzn5,butylmethylpyrazolecarboxylicacid PubChem CID: 720529 IUPAC Name: 5-tert-butyl-2-methylpyrazole-3-carboxylic acid SMILES: CC(C)(C)C1=NN(C(=C1)C(=O)O)C
| PubChem CID | 720529 |
|---|---|
| CAS | 175277-11-9 |
| Molecular Weight (g/mol) | 182.22 |
| SMILES | CC(C)(C)C1=NN(C(=C1)C(=O)O)C |
| Synonym | 3-tert-butyl-1-methyl-1h-pyrazole-5-carboxylic acid,3-tert-butyl-1-methylpyrazole-5-carboxylic acid,5-tert-butyl-2-methyl-2h-pyrazole-3-carboxylic acid,1h-pyrazole-5-carboxylic acid, 3-1,1-dimethylethyl-1-methyl,3-t-butyl-1-methyl-1h-pyrazole-5-carboxylic acid,maybridge1_008671,acmc-1bzn5,butylmethylpyrazolecarboxylicacid |
| IUPAC Name | 5-tert-butyl-2-methylpyrazole-3-carboxylic acid |
| InChI Key | SFSXXMXHJOSBAZ-UHFFFAOYSA-N |
| Molecular Formula | C9H14N2O2 |
p-Tolylacetic acid, 99%
CAS: 622-47-9 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.18 MDL Number: MFCD00004353 InChI Key: GXXXUZIRGXYDFP-UHFFFAOYSA-N Synonym: p-tolylacetic acid,4-methylphenylacetic acid,2-p-tolyl acetic acid,2-4-methylphenyl acetic acid,p-methylphenylacetic acid,4-tolylacetic acid,4-methylphenyl acetic acid,benzeneacetic acid, 4-methyl,acetic acid, p-tolyl,2-p-tolylacetic acid PubChem CID: 248474 IUPAC Name: 2-(4-methylphenyl)acetic acid SMILES: CC1=CC=C(C=C1)CC(=O)O
| PubChem CID | 248474 |
|---|---|
| CAS | 622-47-9 |
| Molecular Weight (g/mol) | 150.18 |
| MDL Number | MFCD00004353 |
| SMILES | CC1=CC=C(C=C1)CC(=O)O |
| Synonym | p-tolylacetic acid,4-methylphenylacetic acid,2-p-tolyl acetic acid,2-4-methylphenyl acetic acid,p-methylphenylacetic acid,4-tolylacetic acid,4-methylphenyl acetic acid,benzeneacetic acid, 4-methyl,acetic acid, p-tolyl,2-p-tolylacetic acid |
| IUPAC Name | 2-(4-methylphenyl)acetic acid |
| InChI Key | GXXXUZIRGXYDFP-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
4-Biphenylacetic acid, 98%
CAS: 5728-52-9 MDL Number: MFCD00004351 InChI Key: QRZAKQDHEVVFRX-UHFFFAOYSA-N Synonym: 4-biphenylacetic acid,felbinac,4-biphenylylacetic acid,traxam,dolinac,4-carboxymethylbiphenyl,napageln,2-4-phenylphenyl acetic acid,p-biphenylylacetic acid,1,1'-biphenyl-4-acetic acid PubChem CID: 3332 ChEBI: CHEBI:31597 IUPAC Name: 2-(4-phenylphenyl)acetic acid SMILES: C1=CC=C(C=C1)C2=CC=C(C=C2)CC(=O)O
| PubChem CID | 3332 |
|---|---|
| CAS | 5728-52-9 |
| ChEBI | CHEBI:31597 |
| MDL Number | MFCD00004351 |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)CC(=O)O |
| Synonym | 4-biphenylacetic acid,felbinac,4-biphenylylacetic acid,traxam,dolinac,4-carboxymethylbiphenyl,napageln,2-4-phenylphenyl acetic acid,p-biphenylylacetic acid,1,1'-biphenyl-4-acetic acid |
| IUPAC Name | 2-(4-phenylphenyl)acetic acid |
| InChI Key | QRZAKQDHEVVFRX-UHFFFAOYSA-N |
Ethyl 3-mercaptopropionate, 98%
CAS: 5466-06-8 IUPAC Name: ethyl 3-sulfanylpropanoate
| CAS | 5466-06-8 |
|---|---|
| IUPAC Name | ethyl 3-sulfanylpropanoate |
o-Tolylacetic acid, 99%
CAS: 644-36-0 Molecular Formula: C9H10O2 Molecular Weight (g/mol): 150.177 MDL Number: MFCD00004328 InChI Key: RZWGTXHSYZGXKF-UHFFFAOYSA-N Synonym: o-tolylacetic acid,2-methylphenylacetic acid,2-methylphenyl acetic acid,2-2-methylphenyl acetic acid,2-o-tolyl acetic acid,2-tolylacetic acid,2-o-tolylacetic acid,o-methylphenylacetic acid,o-tolyacetic acid PubChem CID: 69519 IUPAC Name: 2-(2-methylphenyl)acetic acid SMILES: CC1=CC=CC=C1CC(=O)O
| PubChem CID | 69519 |
|---|---|
| CAS | 644-36-0 |
| Molecular Weight (g/mol) | 150.177 |
| MDL Number | MFCD00004328 |
| SMILES | CC1=CC=CC=C1CC(=O)O |
| Synonym | o-tolylacetic acid,2-methylphenylacetic acid,2-methylphenyl acetic acid,2-2-methylphenyl acetic acid,2-o-tolyl acetic acid,2-tolylacetic acid,2-o-tolylacetic acid,o-methylphenylacetic acid,o-tolyacetic acid |
| IUPAC Name | 2-(2-methylphenyl)acetic acid |
| InChI Key | RZWGTXHSYZGXKF-UHFFFAOYSA-N |
| Molecular Formula | C9H10O2 |
Gallic acid ethyl ester, 99%
CAS: 831-61-8 Molecular Formula: C9H10O5 Molecular Weight (g/mol): 198.174 MDL Number: MFCD00016430 InChI Key: VFPFQHQNJCMNBZ-UHFFFAOYSA-N Synonym: ethyl gallate,gallic acid ethyl ester,phyllemblin,nipagallin a,progallin a,ethylgallate,nipa no. 48,gallic acid, ethyl ester,benzoic acid, 3,4,5-trihydroxy-, ethyl ester,nipa 48 PubChem CID: 13250 ChEBI: CHEBI:87247 IUPAC Name: ethyl 3,4,5-trihydroxybenzoate SMILES: CCOC(=O)C1=CC(=C(C(=C1)O)O)O
| PubChem CID | 13250 |
|---|---|
| CAS | 831-61-8 |
| Molecular Weight (g/mol) | 198.174 |
| ChEBI | CHEBI:87247 |
| MDL Number | MFCD00016430 |
| SMILES | CCOC(=O)C1=CC(=C(C(=C1)O)O)O |
| Synonym | ethyl gallate,gallic acid ethyl ester,phyllemblin,nipagallin a,progallin a,ethylgallate,nipa no. 48,gallic acid, ethyl ester,benzoic acid, 3,4,5-trihydroxy-, ethyl ester,nipa 48 |
| IUPAC Name | ethyl 3,4,5-trihydroxybenzoate |
| InChI Key | VFPFQHQNJCMNBZ-UHFFFAOYSA-N |
| Molecular Formula | C9H10O5 |
3-(4-Carboxyphenyl)propionic acid, 98%
CAS: 38628-51-2 Molecular Formula: C10H10O4 Molecular Weight (g/mol): 194.19 MDL Number: MFCD00016560 InChI Key: QSPCOYVUYYFWAU-UHFFFAOYSA-N Synonym: 4-2-carboxyethyl benzoic acid,3-4-carboxyphenyl propionic acid,3-4-carboxyphenyl propanoic acid,benzenepropanoic acid, 4-carboxy,pubchem19268,acmc-1ctf7,4-carboxyhydrocinnamic acid,4-carboxybenzenepropionic acid,4-2-carboxyethyl benzoicacid,carboxyphenylpropionicacid; 985 PubChem CID: 854054 IUPAC Name: 4-(2-carboxyethyl)benzoic acid SMILES: OC(=O)CCC1=CC=C(C=C1)C(O)=O
| PubChem CID | 854054 |
|---|---|
| CAS | 38628-51-2 |
| Molecular Weight (g/mol) | 194.19 |
| MDL Number | MFCD00016560 |
| SMILES | OC(=O)CCC1=CC=C(C=C1)C(O)=O |
| Synonym | 4-2-carboxyethyl benzoic acid,3-4-carboxyphenyl propionic acid,3-4-carboxyphenyl propanoic acid,benzenepropanoic acid, 4-carboxy,pubchem19268,acmc-1ctf7,4-carboxyhydrocinnamic acid,4-carboxybenzenepropionic acid,4-2-carboxyethyl benzoicacid,carboxyphenylpropionicacid; 985 |
| IUPAC Name | 4-(2-carboxyethyl)benzoic acid |
| InChI Key | QSPCOYVUYYFWAU-UHFFFAOYSA-N |
| Molecular Formula | C10H10O4 |
5-Norbornene-2-carboxylic acid, 98%, mixture of isomers, Thermo Scientific Chemicals
CAS: 120-74-1 Molecular Formula: C8H10O2 Molecular Weight (g/mol): 138.16 InChI Key: FYGUSUBEMUKACF-UHFFFAOYSA-N Synonym: 5-norbornene-2-carboxylic acid,bicyclo 2.2.1 hept-5-ene-2-carboxylic acid,norbornenecarboxylic acid,exo-5-norbornene-2-carboxylic acid,5-norbornene-2-carboxylic acid, exo,5-norbornene-2-carboxylic acid 8ci,bicyclo 2.2.1 hept-2-ene-5-carboxylic acid,bicyclo 2.2.1-5-heptene-2-carboxylic acid,norborn-5-ene-2-carboxylic acid PubChem CID: 78949 IUPAC Name: bicyclo[2.2.1]hept-2-ene-5-carboxylic acid SMILES: C1C2CC(C1C=C2)C(=O)O
| PubChem CID | 78949 |
|---|---|
| CAS | 120-74-1 |
| Molecular Weight (g/mol) | 138.16 |
| SMILES | C1C2CC(C1C=C2)C(=O)O |
| Synonym | 5-norbornene-2-carboxylic acid,bicyclo 2.2.1 hept-5-ene-2-carboxylic acid,norbornenecarboxylic acid,exo-5-norbornene-2-carboxylic acid,5-norbornene-2-carboxylic acid, exo,5-norbornene-2-carboxylic acid 8ci,bicyclo 2.2.1 hept-2-ene-5-carboxylic acid,bicyclo 2.2.1-5-heptene-2-carboxylic acid,norborn-5-ene-2-carboxylic acid |
| IUPAC Name | bicyclo[2.2.1]hept-2-ene-5-carboxylic acid |
| InChI Key | FYGUSUBEMUKACF-UHFFFAOYSA-N |
| Molecular Formula | C8H10O2 |
Ethyl propionate, 99+%
CAS: 105-37-3 Molecular Formula: C5H10O2 Molecular Weight (g/mol): 102.13 MDL Number: MFCD00009308 InChI Key: FKRCODPIKNYEAC-UHFFFAOYSA-N Synonym: ethyl propionate,propanoic acid, ethyl ester,propionic ester,propionic ether,propionic acid, ethyl ester,ethylpropionate,propionate d'ethyle,propanoic acid ethyl ester,ethyl n-propionate,propionic acid ethyl ester PubChem CID: 7749 ChEBI: CHEBI:41330 IUPAC Name: ethyl propanoate SMILES: CCC(=O)OCC
| PubChem CID | 7749 |
|---|---|
| CAS | 105-37-3 |
| Molecular Weight (g/mol) | 102.13 |
| ChEBI | CHEBI:41330 |
| MDL Number | MFCD00009308 |
| SMILES | CCC(=O)OCC |
| Synonym | ethyl propionate,propanoic acid, ethyl ester,propionic ester,propionic ether,propionic acid, ethyl ester,ethylpropionate,propionate d'ethyle,propanoic acid ethyl ester,ethyl n-propionate,propionic acid ethyl ester |
| IUPAC Name | ethyl propanoate |
| InChI Key | FKRCODPIKNYEAC-UHFFFAOYSA-N |
| Molecular Formula | C5H10O2 |
1-Benzothiophene-5-carboxylic acid, 97%, Thermo Scientific™
CAS: 2060-64-2 Molecular Formula: C9H6O2S Molecular Weight (g/mol): 178.21 MDL Number: MFCD04974042 InChI Key: SNBYTKLWZRHESA-UHFFFAOYSA-N Synonym: benzo b thiophene-5-carboxylic acid,buttpark 98\04-76,pubchem20599,5-carboxybenzo b thiophene,benzothiophene-5-carboxylic acid,benzo b thiophene-5-carboxylicacid,1-benzo b thiophene-5-carboxylic acid PubChem CID: 2795444 IUPAC Name: 1-benzothiophene-5-carboxylic acid SMILES: OC(=O)C1=CC=C2SC=CC2=C1
| PubChem CID | 2795444 |
|---|---|
| CAS | 2060-64-2 |
| Molecular Weight (g/mol) | 178.21 |
| MDL Number | MFCD04974042 |
| SMILES | OC(=O)C1=CC=C2SC=CC2=C1 |
| Synonym | benzo b thiophene-5-carboxylic acid,buttpark 98\04-76,pubchem20599,5-carboxybenzo b thiophene,benzothiophene-5-carboxylic acid,benzo b thiophene-5-carboxylicacid,1-benzo b thiophene-5-carboxylic acid |
| IUPAC Name | 1-benzothiophene-5-carboxylic acid |
| InChI Key | SNBYTKLWZRHESA-UHFFFAOYSA-N |
| Molecular Formula | C9H6O2S |
Cycloheptylacetic acid, 99%
CAS: 4401-20-1 Molecular Formula: C9H16O2 Molecular Weight (g/mol): 156.225 MDL Number: MFCD01075701 InChI Key: DQNWKASPZFJVMJ-UHFFFAOYSA-N Synonym: cycloheptylacetic acid,cycloheptaneacetic acid,2-cycloheptylaceticacid,pubchem16200,acmc-20ald3 PubChem CID: 227401 IUPAC Name: 2-cycloheptylacetic acid SMILES: C1CCCC(CC1)CC(=O)O
| PubChem CID | 227401 |
|---|---|
| CAS | 4401-20-1 |
| Molecular Weight (g/mol) | 156.225 |
| MDL Number | MFCD01075701 |
| SMILES | C1CCCC(CC1)CC(=O)O |
| Synonym | cycloheptylacetic acid,cycloheptaneacetic acid,2-cycloheptylaceticacid,pubchem16200,acmc-20ald3 |
| IUPAC Name | 2-cycloheptylacetic acid |
| InChI Key | DQNWKASPZFJVMJ-UHFFFAOYSA-N |
| Molecular Formula | C9H16O2 |
3-Cyclohexenecarboxylic acid, 97%, Thermo Scientific Chemicals
CAS: 4771-80-6 Molecular Formula: C7H10O2 Molecular Weight (g/mol): 126.15 MDL Number: MFCD00013781 InChI Key: VUSWCWPCANWBFG-UHFFFAOYSA-N Synonym: 3-cyclohexene-1-carboxylic acid,3-cyclohexenecarboxylic acid,cyclohex-3-enecarboxylic acid,1,2,3,6-tetrahydrobenzoic acid,1-cyclohexene-4-carboxylic acid,delta3-cyclohexenylcarboxylic acid,kyselina 1,2,5,6-tetrahydrobenzoova,3-cyclohexene carboxylic acid,kyselina 1,2,5,6-tetrahydrobenzoova czech,.delta.3-cyclohexenecarboxylic acid PubChem CID: 20903 IUPAC Name: cyclohex-3-ene-1-carboxylic acid SMILES: C1CC(CC=C1)C(=O)O
| PubChem CID | 20903 |
|---|---|
| CAS | 4771-80-6 |
| Molecular Weight (g/mol) | 126.15 |
| MDL Number | MFCD00013781 |
| SMILES | C1CC(CC=C1)C(=O)O |
| Synonym | 3-cyclohexene-1-carboxylic acid,3-cyclohexenecarboxylic acid,cyclohex-3-enecarboxylic acid,1,2,3,6-tetrahydrobenzoic acid,1-cyclohexene-4-carboxylic acid,delta3-cyclohexenylcarboxylic acid,kyselina 1,2,5,6-tetrahydrobenzoova,3-cyclohexene carboxylic acid,kyselina 1,2,5,6-tetrahydrobenzoova czech,.delta.3-cyclohexenecarboxylic acid |
| IUPAC Name | cyclohex-3-ene-1-carboxylic acid |
| InChI Key | VUSWCWPCANWBFG-UHFFFAOYSA-N |
| Molecular Formula | C7H10O2 |
Ethyl isovalerate, 98%
CAS: 108-64-5 Molecular Formula: C7H14O2 Molecular Weight (g/mol): 130.187 MDL Number: MFCD00009203 InChI Key: PPXUHEORWJQRHJ-UHFFFAOYSA-N Synonym: ethyl isovalerate,ethyl 3-methylbutyrate,ethylisovalerate,ethyl isopentanoate,isovaleric acid, ethyl ester,butanoic acid, 3-methyl-, ethyl ester,ethyl beta-methylbutyrate,ethyl isovalerianate,3-methylbutyric acid ethyl ester,3-methylbutanoic acid ethyl ester PubChem CID: 7945 ChEBI: CHEBI:31571 IUPAC Name: ethyl 3-methylbutanoate SMILES: CCOC(=O)CC(C)C
| PubChem CID | 7945 |
|---|---|
| CAS | 108-64-5 |
| Molecular Weight (g/mol) | 130.187 |
| ChEBI | CHEBI:31571 |
| MDL Number | MFCD00009203 |
| SMILES | CCOC(=O)CC(C)C |
| Synonym | ethyl isovalerate,ethyl 3-methylbutyrate,ethylisovalerate,ethyl isopentanoate,isovaleric acid, ethyl ester,butanoic acid, 3-methyl-, ethyl ester,ethyl beta-methylbutyrate,ethyl isovalerianate,3-methylbutyric acid ethyl ester,3-methylbutanoic acid ethyl ester |
| IUPAC Name | ethyl 3-methylbutanoate |
| InChI Key | PPXUHEORWJQRHJ-UHFFFAOYSA-N |
| Molecular Formula | C7H14O2 |